C21H18N2O4 — CID 135201763
ethyl (3R)-1-(1,3-benzodioxol-5-yl)-4,9-dihydro-3H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 135201763) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl (3R)-1-(1,3-benzodioxol-5-yl)-4,9-dihydro-3H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl (3R)-1-(1,3-benzodioxol-5-yl)-4,9-dihydro-3H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 135201763 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl (3R)-1-(1,3-benzodioxol-5-yl)-4,9-dihydro-3H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1Cc2c([nH]c3ccccc23)C(c2ccc3c(c2)OCO3)=N1 |
| InChI | InChI=1S/C21H18N2O4/c1-2-25-21(24)16-10-14-13-5-3-4-6-15(13)22-20(14)19(23-16)12-7-8-17-18(9-12)27-11-26-17/h3-9,16,22H,2,10-11H2,1H3/t16-/m1/s1 |
| InChIKey | XSDKATNSXRZPLG-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|