C28H26N2O6 — CID 10277859
diethyl 10-(1,3-benzodioxol-5-yl)-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxylate (PubChem CID 10277859) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is diethyl 10-(1,3-benzodioxol-5-yl)-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxylate.
| Compound Name | diethyl 10-(1,3-benzodioxol-5-yl)-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10277859 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | diethyl 10-(1,3-benzodioxol-5-yl)-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2n(c1C)C(c1ccc3c(c1)OCO3)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C28H26N2O6/c1-4-33-27(31)23-15(3)30-20(24(23)28(32)34-5-2)13-18-17-8-6-7-9-19(17)29-25(18)26(30)16-10-11-21-22(12-16)36-14-35-21/h6-12,26,29H,4-5,13-14H2,1-3H3 |
| InChIKey | FCVIZZAEBRNZQW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|