C26H24N2O4 — CID 10180975
ethyl 10-(1,3-benzodioxol-5-yl)-1-ethyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxylate (PubChem CID 10180975) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 10-(1,3-benzodioxol-5-yl)-1-ethyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxylate.
| Compound Name | ethyl 10-(1,3-benzodioxol-5-yl)-1-ethyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10180975 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 10-(1,3-benzodioxol-5-yl)-1-ethyl-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)n2c1Cc1c([nH]c3ccccc13)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H24N2O4/c1-3-16-12-19(26(29)30-4-2)21-13-18-17-7-5-6-8-20(17)27-24(18)25(28(16)21)15-9-10-22-23(11-15)32-14-31-22/h5-12,25,27H,3-4,13-14H2,1-2H3 |
| InChIKey | OMCTUOMYOGJQIU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|