C28H25N3O4 — CID 10205263
5-[(10R)-10-(1,3-benzodioxol-5-yl)-3-cyano-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indol-2-yl]pentanoic acid (PubChem CID 10205263) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 5-[(10R)-10-(1,3-benzodioxol-5-yl)-3-cyano-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indol-2-yl]pentanoic acid.
| Compound Name | 5-[(10R)-10-(1,3-benzodioxol-5-yl)-3-cyano-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 10205263 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 5-[(10R)-10-(1,3-benzodioxol-5-yl)-3-cyano-1-methyl-9,10-dihydro-4H-indolizino[6,7-b]indol-2-yl]pentanoic acid |
| SMILES | Cc1c(CCCCC(=O)O)c(C#N)c2n1[C@H](c1ccc3c(c1)OCO3)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C28H25N3O4/c1-16-18(6-3-5-9-26(32)33)21(14-29)23-13-20-19-7-2-4-8-22(19)30-27(20)28(31(16)23)17-10-11-24-25(12-17)35-15-34-24/h2,4,7-8,10-12,28,30H,3,5-6,9,13,15H2,1H3,(H,32,33)/t28-/m1/s1 |
| InChIKey | KYICNBCZMJZBHP-MUUNZHRXSA-N |
| XLogP | 5.22 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|