C29H30N4O4 — CID 10278552
10-(1,3-benzodioxol-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide (PubChem CID 10278552) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 10278552 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-1-methyl-N-(2-morpholin-4-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN2CCOCC2)c2n1C(c1ccc3c(c1)OCO3)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C29H30N4O4/c1-18-14-22(29(34)30-8-9-32-10-12-35-13-11-32)24-16-21-20-4-2-3-5-23(20)31-27(21)28(33(18)24)19-6-7-25-26(15-19)37-17-36-25/h2-7,14-15,28,31H,8-13,16-17H2,1H3,(H,30,34) |
| InChIKey | SJPCAMCRLVVREU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|