C24H20N2O4 — CID 10294405
ethyl 10-(1,3-benzodioxol-5-yl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2-carboxylate (PubChem CID 10294405) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is ethyl 10-(1,3-benzodioxol-5-yl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2-carboxylate.
| Compound Name | ethyl 10-(1,3-benzodioxol-5-yl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 10294405 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | ethyl 10-(1,3-benzodioxol-5-yl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(c1)C(c1ccc3c(c1)OCO3)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C24H20N2O4/c1-2-28-24(27)15-9-16-11-18-17-5-3-4-6-19(17)25-22(18)23(26(16)12-15)14-7-8-20-21(10-14)30-13-29-20/h3-10,12,23,25H,2,11,13H2,1H3 |
| InChIKey | PJHPMARKAPCNHE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|