C17H22N2O — CID 21234649
3-(diethylaminomethyl)-1,2,3,9-tetrahydrocarbazol-4-one (PubChem CID 21234649) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(diethylaminomethyl)-1,2,3,9-tetrahydrocarbazol-4-one.
| Compound Name | 3-(diethylaminomethyl)-1,2,3,9-tetrahydrocarbazol-4-one |
|---|---|
| PubChem CID | 21234649 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-(diethylaminomethyl)-1,2,3,9-tetrahydrocarbazol-4-one |
| SMILES | CCN(CC)CC1CCc2[nH]c3ccccc3c2C1=O |
| InChI | InChI=1S/C17H22N2O/c1-3-19(4-2)11-12-9-10-15-16(17(12)20)13-7-5-6-8-14(13)18-15/h5-8,12,18H,3-4,9-11H2,1-2H3 |
| InChIKey | JVPFUYMHTYKDPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |