C13H13NO — CID 4165022
2-methyl-1,2,3,9-tetrahydrocarbazol-4-one (PubChem CID 4165022) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-methyl-1,2,3,9-tetrahydrocarbazol-4-one.
| Compound Name | 2-methyl-1,2,3,9-tetrahydrocarbazol-4-one |
|---|---|
| PubChem CID | 4165022 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-methyl-1,2,3,9-tetrahydrocarbazol-4-one |
| SMILES | CC1CC(=O)c2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C13H13NO/c1-8-6-11-13(12(15)7-8)9-4-2-3-5-10(9)14-11/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | MNDQLNHLTBCQTK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |