C19H14ClNO2 — CID 23318729
7-chloro-3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione (PubChem CID 23318729) has the molecular formula C19H14ClNO2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 7-chloro-3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione.
| Compound Name | 7-chloro-3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione |
|---|---|
| PubChem CID | 23318729 |
| Molecular Formula | C19H14ClNO2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 7-chloro-3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione |
| SMILES | O=C1CC(c2ccccc2)Cc2[nH]c3ccc(Cl)cc3c(=O)c21 |
| InChI | InChI=1S/C19H14ClNO2/c20-13-6-7-15-14(10-13)19(23)18-16(21-15)8-12(9-17(18)22)11-4-2-1-3-5-11/h1-7,10,12H,8-9H2,(H,21,23) |
| InChIKey | BYTWFPNOCPLVLE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |