C15H13NO2 — CID 30033725
(7R)-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 30033725) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is (7R)-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | (7R)-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 30033725 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (7R)-7-phenyl-1,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | O=C1C[C@H](c2ccccc2)Cc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C15H13NO2/c17-14-9-11(10-4-2-1-3-5-10)8-13-12(14)6-7-15(18)16-13/h1-7,11H,8-9H2,(H,16,18)/t11-/m1/s1 |
| InChIKey | ZCVVEBSDEUINLS-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |