C11H7NO3 — CID 14867937
3,4-dihydrofuro[3,4-b]quinoline-1,9-dione (PubChem CID 14867937) has the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. Its IUPAC name is 3,4-dihydrofuro[3,4-b]quinoline-1,9-dione.
| Compound Name | 3,4-dihydrofuro[3,4-b]quinoline-1,9-dione |
|---|---|
| PubChem CID | 14867937 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3,4-dihydrofuro[3,4-b]quinoline-1,9-dione |
| SMILES | O=C1OCc2[nH]c3ccccc3c(=O)c21 |
| InChI | InChI=1S/C11H7NO3/c13-10-6-3-1-2-4-7(6)12-8-5-15-11(14)9(8)10/h1-4H,5H2,(H,12,13) |
| InChIKey | ZSVZZDFIVRYJAS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |