C16H11NO2 — CID 102164311
6,7-dihydrochromeno[3,4-b]quinolin-12-one (PubChem CID 102164311) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6,7-dihydrochromeno[3,4-b]quinolin-12-one.
| Compound Name | 6,7-dihydrochromeno[3,4-b]quinolin-12-one |
|---|---|
| PubChem CID | 102164311 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6,7-dihydrochromeno[3,4-b]quinolin-12-one |
| SMILES | O=c1c2c([nH]c3ccccc13)COc1ccccc1-2 |
| InChI | InChI=1S/C16H11NO2/c18-16-10-5-1-3-7-12(10)17-13-9-19-14-8-4-2-6-11(14)15(13)16/h1-8H,9H2,(H,17,18) |
| InChIKey | RXERYJIDVUYQGU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |