C23H15NO3 — CID 20828072
6,7-dimethyl-13H-naphtho[2,3-c]acridine-5,8,14-trione (PubChem CID 20828072) has the molecular formula C23H15NO3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 6,7-dimethyl-13H-naphtho[2,3-c]acridine-5,8,14-trione.
| Compound Name | 6,7-dimethyl-13H-naphtho[2,3-c]acridine-5,8,14-trione |
|---|---|
| PubChem CID | 20828072 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 6,7-dimethyl-13H-naphtho[2,3-c]acridine-5,8,14-trione |
| SMILES | Cc1c2c(c3[nH]c4ccccc4c(=O)c3c1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H15NO3/c1-11-12(2)18-20(24-16-10-6-5-9-15(16)23(18)27)19-17(11)21(25)13-7-3-4-8-14(13)22(19)26/h3-10H,1-2H3,(H,24,27) |
| InChIKey | UKYVYHKRRHTQQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|