C27H15NO3S — CID 20781479
4-phenylsulfanyl-13H-naphtho[3,2-c]acridine-5,8,14-trione (PubChem CID 20781479) has the molecular formula C27H15NO3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-phenylsulfanyl-13H-naphtho[3,2-c]acridine-5,8,14-trione.
| Compound Name | 4-phenylsulfanyl-13H-naphtho[3,2-c]acridine-5,8,14-trione |
|---|---|
| PubChem CID | 20781479 |
| Molecular Formula | C27H15NO3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-phenylsulfanyl-13H-naphtho[3,2-c]acridine-5,8,14-trione |
| SMILES | O=C1c2ccc3c(=O)c4ccccc4[nH]c3c2C(=O)c2cccc(Sc3ccccc3)c21 |
| InChI | InChI=1S/C27H15NO3S/c29-25-16-9-4-5-11-20(16)28-24-19(25)14-13-18-23(24)27(31)17-10-6-12-21(22(17)26(18)30)32-15-7-2-1-3-8-15/h1-14H,(H,28,29) |
| InChIKey | XWBLBLRNPLIRFE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|