C28H16N2O4 — CID 20781477
N-(5,8,14-trioxo-13H-naphtho[2,3-c]acridin-6-yl)benzamide (PubChem CID 20781477) has the molecular formula C28H16N2O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is N-(5,8,14-trioxo-13H-naphtho[2,3-c]acridin-6-yl)benzamide.
| Compound Name | N-(5,8,14-trioxo-13H-naphtho[2,3-c]acridin-6-yl)benzamide |
|---|---|
| PubChem CID | 20781477 |
| Molecular Formula | C28H16N2O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-(5,8,14-trioxo-13H-naphtho[2,3-c]acridin-6-yl)benzamide |
| SMILES | O=C(Nc1cc2c(=O)c3ccccc3[nH]c2c2c1C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C28H16N2O4/c31-25-18-12-6-7-13-20(18)29-24-19(25)14-21(30-28(34)15-8-2-1-3-9-15)22-23(24)27(33)17-11-5-4-10-16(17)26(22)32/h1-14H,(H,29,31)(H,30,34) |
| InChIKey | VLWUNUMGBNJPII-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|