C36H19N3O6 — CID 165340131
N-(20-amino-5,12,17,22,29-pentaoxo-2-azaheptacyclo[16.12.0.03,16.04,13.06,11.021,30.023,28]triaconta-1(30),3,6,8,10,13,15,18,20,23,25,27-dodecaen-14-yl)benzamide (PubChem CID 165340131) has the molecular formula C36H19N3O6 and a molecular weight of 589.56 g/mol. Its IUPAC name is N-(20-amino-5,12,17,22,29-pentaoxo-2-azaheptacyclo[16.12.0.03,16.04,13.06,11.021,30.023,28]triaconta-1(30),3,6,8,10,13,15,18,20,23,25,27-dodecaen-14-yl)benzamide.
| Compound Name | N-(20-amino-5,12,17,22,29-pentaoxo-2-azaheptacyclo[16.12.0.03,16.04,13.06,11.021,30.023,28]triaconta-1(30),3,6,8,10,13,15,18,20,23,25,27-dodecaen-14-yl)benzamide |
|---|---|
| PubChem CID | 165340131 |
| Molecular Formula | C36H19N3O6 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | N-(20-amino-5,12,17,22,29-pentaoxo-2-azaheptacyclo[16.12.0.03,16.04,13.06,11.021,30.023,28]triaconta-1(30),3,6,8,10,13,15,18,20,23,25,27-dodecaen-14-yl)benzamide |
| SMILES | Nc1cc2c(=O)c3cc(NC(=O)c4ccccc4)c4c(=O)c5ccccc5c(=O)c4c3[nH]c2c2c(=O)c3ccccc3c(=O)c12 |
| InChI | InChI=1S/C36H19N3O6/c37-23-14-21-29(27-25(23)32(41)17-10-4-6-12-19(17)34(27)43)39-30-22(31(21)40)15-24(38-36(45)16-8-2-1-3-9-16)26-28(30)35(44)20-13-7-5-11-18(20)33(26)42/h1-15H,37H2,(H,38,45)(H,39,40) |
| InChIKey | RQGRSQVIYMEALJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|