C28H16Cl2N2O4 — CID 10962330
N-(6-benzamido-1,5-dichloro-9,10-dioxoanthracen-2-yl)benzamide (PubChem CID 10962330) has the molecular formula C28H16Cl2N2O4 and a molecular weight of 515.35 g/mol. Its IUPAC name is N-(6-benzamido-1,5-dichloro-9,10-dioxoanthracen-2-yl)benzamide.
| Compound Name | N-(6-benzamido-1,5-dichloro-9,10-dioxoanthracen-2-yl)benzamide |
|---|---|
| PubChem CID | 10962330 |
| Molecular Formula | C28H16Cl2N2O4 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | N-(6-benzamido-1,5-dichloro-9,10-dioxoanthracen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1Cl)C(=O)c1ccc(NC(=O)c3ccccc3)c(Cl)c1C2=O)c1ccccc1 |
| InChI | InChI=1S/C28H16Cl2N2O4/c29-23-19(31-27(35)15-7-3-1-4-8-15)13-11-17-21(23)25(33)18-12-14-20(24(30)22(18)26(17)34)32-28(36)16-9-5-2-6-10-16/h1-14H,(H,31,35)(H,32,36) |
| InChIKey | DCGQODXGWSADBF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|