C27H18N2O4 — CID 21486214
N-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]benzamide (PubChem CID 21486214) has the molecular formula C27H18N2O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]benzamide.
| Compound Name | N-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 21486214 |
| Molecular Formula | C27H18N2O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(O)c3c2C(=O)c2ccccc2C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H18N2O4/c30-22-15-14-21(23-24(22)26(32)20-9-5-4-8-19(20)25(23)31)28-17-10-12-18(13-11-17)29-27(33)16-6-2-1-3-7-16/h1-15,28,30H,(H,29,33) |
| InChIKey | AQMIIASXMSBWRZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|