C35H29N3O3 — CID 14597527
1-hydroxy-4,5,8-tris(4-methylanilino)anthracene-9,10-dione (PubChem CID 14597527) has the molecular formula C35H29N3O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 1-hydroxy-4,5,8-tris(4-methylanilino)anthracene-9,10-dione.
| Compound Name | 1-hydroxy-4,5,8-tris(4-methylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 14597527 |
| Molecular Formula | C35H29N3O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 1-hydroxy-4,5,8-tris(4-methylanilino)anthracene-9,10-dione |
| SMILES | Cc1ccc(Nc2ccc(O)c3c2C(=O)c2c(Nc4ccc(C)cc4)ccc(Nc4ccc(C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C35H29N3O3/c1-20-4-10-23(11-5-20)36-26-16-17-27(37-24-12-6-21(2)7-13-24)31-30(26)34(40)32-28(18-19-29(39)33(32)35(31)41)38-25-14-8-22(3)9-15-25/h4-19,36-39H,1-3H3 |
| InChIKey | YAHDEGGGBDBBMT-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|