C28H22N2O10S2 — CID 100912688
4-[[4,8-dihydroxy-5-(2-methyl-4-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]-3-methylbenzenesulfonic acid (PubChem CID 100912688) has the molecular formula C28H22N2O10S2 and a molecular weight of 610.62 g/mol. Its IUPAC name is 4-[[4,8-dihydroxy-5-(2-methyl-4-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]-3-methylbenzenesulfonic acid.
| Compound Name | 4-[[4,8-dihydroxy-5-(2-methyl-4-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 100912688 |
| Molecular Formula | C28H22N2O10S2 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | 4-[[4,8-dihydroxy-5-(2-methyl-4-sulfoanilino)-9,10-dioxoanthracen-1-yl]amino]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1Nc1ccc(O)c2c1C(=O)c1c(O)ccc(Nc3ccc(S(=O)(=O)O)cc3C)c1C2=O |
| InChI | InChI=1S/C28H22N2O10S2/c1-13-11-15(41(35,36)37)3-5-17(13)29-19-7-9-21(31)25-23(19)27(33)26-22(32)10-8-20(24(26)28(25)34)30-18-6-4-16(12-14(18)2)42(38,39)40/h3-12,29-32H,1-2H3,(H,35,36,37)(H,38,39,40) |
| InChIKey | CAHCUHKQYUSQMS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|