C21H15NO6S — CID 23623883
4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-3-methylbenzenesulfonic acid (PubChem CID 23623883) has the molecular formula C21H15NO6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-3-methylbenzenesulfonic acid.
| Compound Name | 4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 23623883 |
| Molecular Formula | C21H15NO6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 4-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)ccc1Nc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15NO6S/c1-11-10-12(29(26,27)28)6-7-15(11)22-16-8-9-17(23)19-18(16)20(24)13-4-2-3-5-14(13)21(19)25/h2-10,22-23H,1H3,(H,26,27,28) |
| InChIKey | NXJDYLOOLINWOC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|