C27H19NO3S — CID 163427506
4-anilino-1-hydroxy-5-(3-methylphenyl)sulfanylanthracene-9,10-dione (PubChem CID 163427506) has the molecular formula C27H19NO3S and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-anilino-1-hydroxy-5-(3-methylphenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 4-anilino-1-hydroxy-5-(3-methylphenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 163427506 |
| Molecular Formula | C27H19NO3S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-anilino-1-hydroxy-5-(3-methylphenyl)sulfanylanthracene-9,10-dione |
| SMILES | Cc1cccc(Sc2cccc3c2C(=O)c2c(Nc4ccccc4)ccc(O)c2C3=O)c1 |
| InChI | InChI=1S/C27H19NO3S/c1-16-7-5-10-18(15-16)32-22-12-6-11-19-23(22)27(31)24-20(28-17-8-3-2-4-9-17)13-14-21(29)25(24)26(19)30/h2-15,28-29H,1H3 |
| InChIKey | ANUDYKUNOUMMQT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|