C62H56N4O4 — CID 159658247
1,4-bis(4-butylanilino)anthracene-9,10-dione;1,4-bis(3-methylanilino)anthracene-9,10-dione (PubChem CID 159658247) has the molecular formula C62H56N4O4 and a molecular weight of 921.15 g/mol. Its IUPAC name is 1,4-bis(4-butylanilino)anthracene-9,10-dione;1,4-bis(3-methylanilino)anthracene-9,10-dione.
| Compound Name | 1,4-bis(4-butylanilino)anthracene-9,10-dione;1,4-bis(3-methylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 159658247 |
| Molecular Formula | C62H56N4O4 |
| Molecular Weight | 921.15 g/mol |
| Exact Mass | 920.43 |
| IUPAC Name | 1,4-bis(4-butylanilino)anthracene-9,10-dione;1,4-bis(3-methylanilino)anthracene-9,10-dione |
| SMILES | CCCCc1ccc(Nc2ccc(Nc3ccc(CCCC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1.Cc1cccc(Nc2ccc(Nc3cccc(C)c3)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C34H34N2O2.C28H22N2O2/c1-3-5-9-23-13-17-25(18-14-23)35-29-21-22-30(36-26-19-15-24(16-20-26)10-6-4-2)32-31(29)33(37)27-11-7-8-12-28(27)34(32)38;1-17-7-5-9-19(15-17)29-23-13-14-24(30-20-10-6-8-18(2)16-20)26-25(23)27(31)21-11-3-4-12-22(21)28(26)32/h7-8,11-22,35-36H,3-6,9-10H2,1-2H3;3-16,29-30H,1-2H3 |
| InChIKey | MSLKWDKHAZCQAM-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.15 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|