C41H39NO4S — CID 177280281
1-[4-[(4-butoxyphenyl)methoxy]phenyl]sulfanyl-5-(4-butylanilino)anthracene-9,10-dione (PubChem CID 177280281) has the molecular formula C41H39NO4S and a molecular weight of 641.83 g/mol. Its IUPAC name is 1-[4-[(4-butoxyphenyl)methoxy]phenyl]sulfanyl-5-(4-butylanilino)anthracene-9,10-dione.
| Compound Name | 1-[4-[(4-butoxyphenyl)methoxy]phenyl]sulfanyl-5-(4-butylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 177280281 |
| Molecular Formula | C41H39NO4S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 1-[4-[(4-butoxyphenyl)methoxy]phenyl]sulfanyl-5-(4-butylanilino)anthracene-9,10-dione |
| SMILES | CCCCOc1ccc(COc2ccc(Sc3cccc4c3C(=O)c3cccc(Nc5ccc(CCCC)cc5)c3C4=O)cc2)cc1 |
| InChI | InChI=1S/C41H39NO4S/c1-3-5-9-28-14-18-30(19-15-28)42-36-12-7-10-34-38(36)40(43)35-11-8-13-37(39(35)41(34)44)47-33-24-22-32(23-25-33)46-27-29-16-20-31(21-17-29)45-26-6-4-2/h7-8,10-25,42H,3-6,9,26-27H2,1-2H3 |
| InChIKey | OJSRIGFNOIVVRQ-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|