C44H45NO4S — CID 177280290
1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-heptoxyanilino)anthracene-9,10-dione (PubChem CID 177280290) has the molecular formula C44H45NO4S and a molecular weight of 683.91 g/mol. Its IUPAC name is 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-heptoxyanilino)anthracene-9,10-dione.
| Compound Name | 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-heptoxyanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 177280290 |
| Molecular Formula | C44H45NO4S |
| Molecular Weight | 683.91 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-heptoxyanilino)anthracene-9,10-dione |
| SMILES | CCCCCCCOc1ccc(Nc2cccc3c2C(=O)c2cccc(Sc4ccc(OCc5ccc(C(C)(C)C)cc5)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C44H45NO4S/c1-5-6-7-8-9-28-48-33-22-20-32(21-23-33)45-38-14-10-12-36-40(38)42(46)37-13-11-15-39(41(37)43(36)47)50-35-26-24-34(25-27-35)49-29-30-16-18-31(19-17-30)44(2,3)4/h10-27,45H,5-9,28-29H2,1-4H3 |
| InChIKey | VWIKGLPFFXEMQP-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.91 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|