C41H38O3S2 — CID 171457841
1-[4-[(4-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-tert-butylphenyl)sulfanylanthracene-9,10-dione (PubChem CID 171457841) has the molecular formula C41H38O3S2 and a molecular weight of 642.89 g/mol. Its IUPAC name is 1-[4-[(4-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-tert-butylphenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 1-[4-[(4-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-tert-butylphenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 171457841 |
| Molecular Formula | C41H38O3S2 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | 1-[4-[(4-butylphenyl)methoxy]phenyl]sulfanyl-5-(4-tert-butylphenyl)sulfanylanthracene-9,10-dione |
| SMILES | CCCCc1ccc(COc2ccc(Sc3cccc4c3C(=O)c3cccc(Sc5ccc(C(C)(C)C)cc5)c3C4=O)cc2)cc1 |
| InChI | InChI=1S/C41H38O3S2/c1-5-6-9-27-14-16-28(17-15-27)26-44-30-20-24-32(25-21-30)46-36-13-8-11-34-38(36)40(43)33-10-7-12-35(37(33)39(34)42)45-31-22-18-29(19-23-31)41(2,3)4/h7-8,10-25H,5-6,9,26H2,1-4H3 |
| InChIKey | UXWBXXIKONJVMK-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|