C26H23ClO2S — CID 59690900
1-chloro-5-(4-hexylphenyl)sulfanylanthracene-9,10-dione (PubChem CID 59690900) has the molecular formula C26H23ClO2S and a molecular weight of 434.99 g/mol. Its IUPAC name is 1-chloro-5-(4-hexylphenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 1-chloro-5-(4-hexylphenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 59690900 |
| Molecular Formula | C26H23ClO2S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-chloro-5-(4-hexylphenyl)sulfanylanthracene-9,10-dione |
| SMILES | CCCCCCc1ccc(Sc2cccc3c2C(=O)c2cccc(Cl)c2C3=O)cc1 |
| InChI | InChI=1S/C26H23ClO2S/c1-2-3-4-5-8-17-13-15-18(16-14-17)30-22-12-7-10-20-24(22)26(29)19-9-6-11-21(27)23(19)25(20)28/h6-7,9-16H,2-5,8H2,1H3 |
| InChIKey | FCVSVGJDHPCLRB-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|