C54H56O2S3 — CID 142211797
4-(4-hexylphenyl)sulfanyl-5-(4-methylcyclohexa-1,3-dien-1-yl)sulfanyl-1-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione (PubChem CID 142211797) has the molecular formula C54H56O2S3 and a molecular weight of 833.24 g/mol. Its IUPAC name is 4-(4-hexylphenyl)sulfanyl-5-(4-methylcyclohexa-1,3-dien-1-yl)sulfanyl-1-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 4-(4-hexylphenyl)sulfanyl-5-(4-methylcyclohexa-1,3-dien-1-yl)sulfanyl-1-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 142211797 |
| Molecular Formula | C54H56O2S3 |
| Molecular Weight | 833.24 g/mol |
| Exact Mass | 832.34 |
| IUPAC Name | 4-(4-hexylphenyl)sulfanyl-5-(4-methylcyclohexa-1,3-dien-1-yl)sulfanyl-1-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CCCCCCc1ccc(Sc2ccc(Sc3ccc(-c4ccc(C5CCC(CCC)CC5)cc4)cc3)c3c2C(=O)c2c(SC4=CC=C(C)CC4)cccc2C3=O)cc1 |
| InChI | InChI=1S/C54H56O2S3/c1-4-6-7-8-11-38-18-30-44(31-19-38)58-49-35-34-48(51-52(49)54(56)50-46(53(51)55)12-9-13-47(50)57-43-28-14-36(3)15-29-43)59-45-32-26-42(27-33-45)41-24-22-40(23-25-41)39-20-16-37(10-5-2)17-21-39/h9,12-14,18-19,22-28,30-35,37,39H,4-8,10-11,15-17,20-21,29H2,1-3H3 |
| InChIKey | HRILPLWGSHJMBY-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.24 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|