C42H38O2S2 — CID 142211743
1-(4-methylphenyl)sulfanyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione (PubChem CID 142211743) has the molecular formula C42H38O2S2 and a molecular weight of 638.90 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfanyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-(4-methylphenyl)sulfanyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 142211743 |
| Molecular Formula | C42H38O2S2 |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 1-(4-methylphenyl)sulfanyl-5-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4cccc(Sc6ccc(C)cc6)c4C5=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C42H38O2S2/c1-3-6-28-13-15-29(16-14-28)30-17-19-31(20-18-30)32-21-25-34(26-22-32)46-38-10-5-8-36-40(38)42(44)35-7-4-9-37(39(35)41(36)43)45-33-23-11-27(2)12-24-33/h4-5,7-12,17-26,28-29H,3,6,13-16H2,1-2H3 |
| InChIKey | BYXJZRIBEQMFEM-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|