C35H32FNO2S — CID 143268284
1-(ethylamino)-5-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione (PubChem CID 143268284) has the molecular formula C35H32FNO2S and a molecular weight of 549.71 g/mol. Its IUPAC name is 1-(ethylamino)-5-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-(ethylamino)-5-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 143268284 |
| Molecular Formula | C35H32FNO2S |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 1-(ethylamino)-5-[4-[2-fluoro-4-(4-methylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CCNc1cccc2c1C(=O)c1cccc(Sc3ccc(-c4ccc(C5CCC(C)CC5)cc4F)cc3)c1C2=O |
| InChI | InChI=1S/C35H32FNO2S/c1-3-37-30-8-4-6-27-32(30)34(38)28-7-5-9-31(33(28)35(27)39)40-25-17-14-23(15-18-25)26-19-16-24(20-29(26)36)22-12-10-21(2)11-13-22/h4-9,14-22,37H,3,10-13H2,1-2H3 |
| InChIKey | AGOXWWRSUJVRCN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|