C37H35FNO2S- — CID 59641497
1-ethylimino-5-[4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl]sulfanyl-10-oxoanthracen-9-olate (PubChem CID 59641497) has the molecular formula C37H35FNO2S- and a molecular weight of 576.76 g/mol. Its IUPAC name is 1-ethylimino-5-[4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl]sulfanyl-10-oxoanthracen-9-olate.
| Compound Name | 1-ethylimino-5-[4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl]sulfanyl-10-oxoanthracen-9-olate |
|---|---|
| PubChem CID | 59641497 |
| Molecular Formula | C37H35FNO2S- |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 1-ethylimino-5-[4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl]sulfanyl-10-oxoanthracen-9-olate |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)C4=CC=C/C(=N\CC)C4=C5[O-])cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C37H36FNO2S/c1-3-7-23-12-14-24(15-13-23)26-18-21-28(31(38)22-26)25-16-19-27(20-17-25)42-33-11-6-9-30-35(33)37(41)29-8-5-10-32(39-4-2)34(29)36(30)40/h5-6,8-11,16-24,40H,3-4,7,12-15H2,1-2H3/p-1/b39-32+ |
| InChIKey | OOOPOUXEOZBPTB-LETMKSKHSA-M |
| XLogP | 8.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|