C57H62N2O2S — CID 59690980
1,4-bis(4-tert-butylanilino)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione (PubChem CID 59690980) has the molecular formula C57H62N2O2S and a molecular weight of 839.20 g/mol. Its IUPAC name is 1,4-bis(4-tert-butylanilino)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 1,4-bis(4-tert-butylanilino)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 59690980 |
| Molecular Formula | C57H62N2O2S |
| Molecular Weight | 839.20 g/mol |
| Exact Mass | 838.45 |
| IUPAC Name | 1,4-bis(4-tert-butylanilino)-5-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4c(Nc6ccc(C(C)(C)C)cc6)ccc(Nc6ccc(C(C)(C)C)cc6)c4C5=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C57H62N2O2S/c1-8-9-10-12-37-15-17-38(18-16-37)39-19-21-40(22-20-39)41-23-33-46(34-24-41)62-50-14-11-13-47-51(50)55(61)53-49(59-45-31-27-43(28-32-45)57(5,6)7)36-35-48(52(53)54(47)60)58-44-29-25-42(26-30-44)56(2,3)4/h11,13-14,19-38,58-59H,8-10,12,15-18H2,1-7H3 |
| InChIKey | BGSXXWRMHFCXHU-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.20 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|