C47H48O2S2 — CID 58612679
2-(4-tert-butylphenyl)sulfanyl-6-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione (PubChem CID 58612679) has the molecular formula C47H48O2S2 and a molecular weight of 709.03 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-6-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-6-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 58612679 |
| Molecular Formula | C47H48O2S2 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-6-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(Sc4ccc5c(c4)C(=O)c4ccc(Sc6ccc(C(C)(C)C)cc6)cc4C5=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C47H48O2S2/c1-5-6-7-8-31-9-11-32(12-10-31)33-13-15-34(16-14-33)35-17-21-37(22-18-35)50-39-25-27-41-43(29-39)45(48)42-28-26-40(30-44(42)46(41)49)51-38-23-19-36(20-24-38)47(2,3)4/h13-32H,5-12H2,1-4H3 |
| InChIKey | KZJVKFXJUVISPF-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|