C40H34O2S3 — CID 143482080
1-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl-5-[4-(sulfanylmethyl)phenyl]sulfanylanthracene-9,10-dione (PubChem CID 143482080) has the molecular formula C40H34O2S3 and a molecular weight of 642.91 g/mol. Its IUPAC name is 1-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl-5-[4-(sulfanylmethyl)phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl-5-[4-(sulfanylmethyl)phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 143482080 |
| Molecular Formula | C40H34O2S3 |
| Molecular Weight | 642.91 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | 1-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl-5-[4-(sulfanylmethyl)phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4cccc(Sc6ccc(CS)cc6)c4C5=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C40H34O2S3/c1-25-8-12-27(13-9-25)28-14-16-29(17-15-28)30-18-22-32(23-19-30)45-36-7-3-5-34-38(36)40(42)33-4-2-6-35(37(33)39(34)41)44-31-20-10-26(24-43)11-21-31/h2-7,10-11,14-23,25,27,43H,8-9,12-13,24H2,1H3 |
| InChIKey | DFASABUSJPJUPA-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.91 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|