C56H50N2O2S2 — CID 143482087
1,8-bis[[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl]-[1,4]benzoxazino[2,3-b]phenoxazine (PubChem CID 143482087) has the molecular formula C56H50N2O2S2 and a molecular weight of 847.16 g/mol. Its IUPAC name is 1,8-bis[[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl]-[1,4]benzoxazino[2,3-b]phenoxazine.
| Compound Name | 1,8-bis[[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl]-[1,4]benzoxazino[2,3-b]phenoxazine |
|---|---|
| PubChem CID | 143482087 |
| Molecular Formula | C56H50N2O2S2 |
| Molecular Weight | 847.16 g/mol |
| Exact Mass | 846.33 |
| IUPAC Name | 1,8-bis[[4-[4-(4-methylcyclohexyl)phenyl]phenyl]sulfanyl]-[1,4]benzoxazino[2,3-b]phenoxazine |
| SMILES | CC1CCC(c2ccc(-c3ccc(Sc4cccc5c4N=c4cc6c(cc4O5)=Nc4c(cccc4Sc4ccc(-c5ccc(C7CCC(C)CC7)cc5)cc4)O6)cc3)cc2)CC1 |
| InChI | InChI=1S/C56H50N2O2S2/c1-35-9-13-37(14-10-35)39-17-21-41(22-18-39)43-25-29-45(30-26-43)61-53-7-3-5-49-55(53)57-47-33-52-48(34-51(47)59-49)58-56-50(60-52)6-4-8-54(56)62-46-31-27-44(28-32-46)42-23-19-40(20-24-42)38-15-11-36(2)12-16-38/h3-8,17-38H,9-16H2,1-2H3 |
| InChIKey | ULCAUSSRDZWYQU-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.16 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|