C26H17NO2S2 — CID 89229492
1-(4-aminophenyl)sulfanyl-5-phenylsulfanylanthracene-9,10-dione (PubChem CID 89229492) has the molecular formula C26H17NO2S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(4-aminophenyl)sulfanyl-5-phenylsulfanylanthracene-9,10-dione.
| Compound Name | 1-(4-aminophenyl)sulfanyl-5-phenylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 89229492 |
| Molecular Formula | C26H17NO2S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1-(4-aminophenyl)sulfanyl-5-phenylsulfanylanthracene-9,10-dione |
| SMILES | Nc1ccc(Sc2cccc3c2C(=O)c2cccc(Sc4ccccc4)c2C3=O)cc1 |
| InChI | InChI=1S/C26H17NO2S2/c27-16-12-14-18(15-13-16)31-22-11-5-9-20-24(22)26(29)19-8-4-10-21(23(19)25(20)28)30-17-6-2-1-3-7-17/h1-15H,27H2 |
| InChIKey | ATVKZRLHSUFZAK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|