C26H16N2O4S — CID 22759166
1-(4-nitroanilino)-5-phenylsulfanylanthracene-9,10-dione (PubChem CID 22759166) has the molecular formula C26H16N2O4S and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-(4-nitroanilino)-5-phenylsulfanylanthracene-9,10-dione.
| Compound Name | 1-(4-nitroanilino)-5-phenylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 22759166 |
| Molecular Formula | C26H16N2O4S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 1-(4-nitroanilino)-5-phenylsulfanylanthracene-9,10-dione |
| SMILES | O=C1c2cccc(Sc3ccccc3)c2C(=O)c2cccc(Nc3ccc([N+](=O)[O-])cc3)c21 |
| InChI | InChI=1S/C26H16N2O4S/c29-25-20-9-5-11-22(33-18-6-2-1-3-7-18)24(20)26(30)19-8-4-10-21(23(19)25)27-16-12-14-17(15-13-16)28(31)32/h1-15,27H |
| InChIKey | STDPCQZORQLZPO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|