C29H23NO2S — CID 22899487
1-phenylsulfanyl-5-(2,4,6-trimethylanilino)anthracene-9,10-dione (PubChem CID 22899487) has the molecular formula C29H23NO2S and a molecular weight of 449.58 g/mol. Its IUPAC name is 1-phenylsulfanyl-5-(2,4,6-trimethylanilino)anthracene-9,10-dione.
| Compound Name | 1-phenylsulfanyl-5-(2,4,6-trimethylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 22899487 |
| Molecular Formula | C29H23NO2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-phenylsulfanyl-5-(2,4,6-trimethylanilino)anthracene-9,10-dione |
| SMILES | Cc1cc(C)c(Nc2cccc3c2C(=O)c2cccc(Sc4ccccc4)c2C3=O)c(C)c1 |
| InChI | InChI=1S/C29H23NO2S/c1-17-15-18(2)27(19(3)16-17)30-23-13-7-11-21-25(23)28(31)22-12-8-14-24(26(22)29(21)32)33-20-9-5-4-6-10-20/h4-16,30H,1-3H3 |
| InChIKey | VOPUPNBLPVXFDT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|