C22H16O2S — CID 54202372
1-methyl-4-(4-methylphenyl)sulfanylanthracene-9,10-dione (PubChem CID 54202372) has the molecular formula C22H16O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 1-methyl-4-(4-methylphenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 54202372 |
| Molecular Formula | C22H16O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)sulfanylanthracene-9,10-dione |
| SMILES | Cc1ccc(Sc2ccc(C)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H16O2S/c1-13-7-10-15(11-8-13)25-18-12-9-14(2)19-20(18)22(24)17-6-4-3-5-16(17)21(19)23/h3-12H,1-2H3 |
| InChIKey | PQDTUYPWGVZOGT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|