C30H31NO4S — CID 90068738
2-ethylhexyl 1-amino-4-(4-methylphenyl)sulfanyl-9,10-dioxoanthracene-2-carboxylate (PubChem CID 90068738) has the molecular formula C30H31NO4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-ethylhexyl 1-amino-4-(4-methylphenyl)sulfanyl-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-ethylhexyl 1-amino-4-(4-methylphenyl)sulfanyl-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 90068738 |
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-ethylhexyl 1-amino-4-(4-methylphenyl)sulfanyl-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc(Sc2ccc(C)cc2)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H31NO4S/c1-4-6-9-19(5-2)17-35-30(34)23-16-24(36-20-14-12-18(3)13-15-20)25-26(27(23)31)29(33)22-11-8-7-10-21(22)28(25)32/h7-8,10-16,19H,4-6,9,17,31H2,1-3H3 |
| InChIKey | IVSIMHLLMWEEHZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|