C17H12O2S — CID 155568888
5-(4-methylphenyl)sulfanylnaphthalene-1,4-dione (PubChem CID 155568888) has the molecular formula C17H12O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfanylnaphthalene-1,4-dione.
| Compound Name | 5-(4-methylphenyl)sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 155568888 |
| Molecular Formula | C17H12O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(4-methylphenyl)sulfanylnaphthalene-1,4-dione |
| SMILES | Cc1ccc(Sc2cccc3c2C(=O)C=CC3=O)cc1 |
| InChI | InChI=1S/C17H12O2S/c1-11-5-7-12(8-6-11)20-16-4-2-3-13-14(18)9-10-15(19)17(13)16/h2-10H,1H3 |
| InChIKey | QZPPRKVITXXTOR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|