C13H14O4 — CID 174921085
5-hydroxynaphthalene-1,4-dione;propan-2-ol (PubChem CID 174921085) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-hydroxynaphthalene-1,4-dione;propan-2-ol.
| Compound Name | 5-hydroxynaphthalene-1,4-dione;propan-2-ol |
|---|---|
| PubChem CID | 174921085 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-hydroxynaphthalene-1,4-dione;propan-2-ol |
| SMILES | CC(C)O.O=C1C=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C10H6O3.C3H8O/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12;1-3(2)4/h1-5,12H;3-4H,1-2H3 |
| InChIKey | PBIWZVQLECWJGV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|