C10H6F4O3 — CID 158904542
5-hydroxynaphthalene-1,4-dione;molecular fluorine (PubChem CID 158904542) has the molecular formula C10H6F4O3 and a molecular weight of 250.15 g/mol. Its IUPAC name is 5-hydroxynaphthalene-1,4-dione;molecular fluorine.
| Compound Name | 5-hydroxynaphthalene-1,4-dione;molecular fluorine |
|---|---|
| PubChem CID | 158904542 |
| Molecular Formula | C10H6F4O3 |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-hydroxynaphthalene-1,4-dione;molecular fluorine |
| SMILES | FF.FF.O=C1C=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C10H6O3.2F2/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12;2*1-2/h1-5,12H;; |
| InChIKey | JFWNDTJCEDLGDV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|