C24H16O4 — CID 174610279
anthracene-1,8-diol;naphthalene-1,4-dione (PubChem CID 174610279) has the molecular formula C24H16O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is anthracene-1,8-diol;naphthalene-1,4-dione.
| Compound Name | anthracene-1,8-diol;naphthalene-1,4-dione |
|---|---|
| PubChem CID | 174610279 |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | anthracene-1,8-diol;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2ccccc21.Oc1cccc2cc3cccc(O)c3cc12 |
| InChI | InChI=1S/C14H10O2.C10H6O2/c15-13-5-1-3-9-7-10-4-2-6-14(16)12(10)8-11(9)13;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8,15-16H;1-6H |
| InChIKey | HPFCTEGHYPIQNI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|