About 4,5-dihydroxyanthracene-1,2-dione
4,5-dihydroxyanthracene-1,2-dione (PubChem CID 18977667) has the molecular formula C14H8O4
and a molecular weight of 240.21 g/mol. Its IUPAC name is 4,5-dihydroxyanthracene-1,2-dione.
Molecular Properties
| Compound Name | 4,5-dihydroxyanthracene-1,2-dione |
| PubChem CID | 18977667 |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 4,5-dihydroxyanthracene-1,2-dione |
| SMILES | O=C1C=C(O)c2cc3c(O)cccc3cc2C1=O |
| InChI | InChI=1S/C14H8O4/c15-11-3-1-2-7-4-10-9(5-8(7)11)12(16)6-13(17)14(10)18/h1-6,15-16H |
| InChIKey | XXHLRESCXZSYLS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxyanthracene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxyanthracene-1,2-dione?
The IUPAC name of 4,5-dihydroxyanthracene-1,2-dione (CID 18977667) is 4,5-dihydroxyanthracene-1,2-dione.
What is the SMILES notation for 4,5-dihydroxyanthracene-1,2-dione?
The canonical SMILES for 4,5-dihydroxyanthracene-1,2-dione is O=C1C=C(O)c2cc3c(O)cccc3cc2C1=O.
What is the InChIKey of 4,5-dihydroxyanthracene-1,2-dione?
The InChIKey is XXHLRESCXZSYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O4/c15-11-3-1-2-7-4-10-9(5-8(7)11)12(16)6-13(17)14(10)18/h1-6,15-16H.
What are the key properties of 4,5-dihydroxyanthracene-1,2-dione?
4,5-dihydroxyanthracene-1,2-dione has a molecular weight of 240.21 g/mol, XLogP of 2.21, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxyanthracene-1,2-dione is sourced from PubChem (CID 18977667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).