About 1,3,8-trihydroxy-6-methylanthracene-9,10-dione
1,3,8-trihydroxy-6-methylanthracene-9,10-dione (PubChem CID 3220) has the molecular formula C15H10O5
and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| PubChem CID | 3220 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3 |
| InChIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1,3,8-trihydroxy-6-methylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,8-trihydroxy-6-methylanthracene-9,10-dione?
The IUPAC name of 1,3,8-trihydroxy-6-methylanthracene-9,10-dione (CID 3220) is 1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
What is the SMILES notation for 1,3,8-trihydroxy-6-methylanthracene-9,10-dione?
The canonical SMILES for 1,3,8-trihydroxy-6-methylanthracene-9,10-dione is Cc1cc(O)c2c(c1)C(=O)c1cc(O)cc(O)c1C2=O.
What is the InChIKey of 1,3,8-trihydroxy-6-methylanthracene-9,10-dione?
The InChIKey is RHMXXJGYXNZAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3.
What are the key properties of 1,3,8-trihydroxy-6-methylanthracene-9,10-dione?
1,3,8-trihydroxy-6-methylanthracene-9,10-dione has a molecular weight of 270.24 g/mol, XLogP of 1.89, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,8-trihydroxy-6-methylanthracene-9,10-dione is sourced from PubChem (CID 3220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).