C15H10O5 — CID 3220
1,3,8-trihydroxy-6-methylanthracene-9,10-dione (PubChem CID 3220) has the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
| Compound Name | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 3220 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3 |
| InChIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|