C14H8O5 — CID 6683
1,2,4-trihydroxyanthracene-9,10-dione (PubChem CID 6683) has the molecular formula C14H8O5 and a molecular weight of 256.21 g/mol. Its IUPAC name is 1,2,4-trihydroxyanthracene-9,10-dione.
| Compound Name | 1,2,4-trihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 6683 |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1,2,4-trihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(O)cc(O)c21 |
| InChI | InChI=1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H |
| InChIKey | BBNQQADTFFCFGB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|