C10H12O4 — CID 15008
1-(2,4,5-trihydroxyphenyl)butan-1-one (PubChem CID 15008) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(2,4,5-trihydroxyphenyl)butan-1-one.
| Compound Name | 1-(2,4,5-trihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 15008 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(2,4,5-trihydroxyphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(O)c(O)cc1O |
| InChI | InChI=1S/C10H12O4/c1-2-3-7(11)6-4-9(13)10(14)5-8(6)12/h4-5,12-14H,2-3H2,1H3 |
| InChIKey | SRUQARLMFOLRDN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|