About Quinizarin
Quinizarin (PubChem CID 6688) has the molecular formula C14H8O4
and a molecular weight of 240.21 g/mol. Its IUPAC name is 1,4-dihydroxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | Quinizarin |
| PubChem CID | 6688 |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1,4-dihydroxyanthracene-9,10-dione |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)O)O |
| InChI | InChI=1S/C14H8O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,15-16H |
| InChIKey | GUEIZVNYDFNHJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | 342 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze Quinizarin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Quinizarin?
The IUPAC name of Quinizarin (CID 6688) is 1,4-dihydroxyanthracene-9,10-dione.
What is the SMILES notation for Quinizarin?
The canonical SMILES for Quinizarin is C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)O)O.
What is the InChIKey of Quinizarin?
The InChIKey is GUEIZVNYDFNHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,15-16H.
What are the key properties of Quinizarin?
Quinizarin has a molecular weight of 240.21 g/mol, XLogP of 3.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Quinizarin is sourced from PubChem (CID 6688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).