About tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one
tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one (PubChem CID 70393273) has the molecular formula C13H8O
and a molecular weight of 180.21 g/mol. Its IUPAC name is tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one.
Analyze tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one?
The IUPAC name of tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one (CID 70393273) is tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one.
What is the SMILES notation for tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one?
The canonical SMILES for tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one is O=C1C=Cc2cc1c1ccccc1c2.
What is the InChIKey of tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one?
The InChIKey is ADHXVDURLGYAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O/c14-13-6-5-9-7-10-3-1-2-4-11(10)12(13)8-9/h1-8H.
What are the key properties of tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one?
tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one has a molecular weight of 180.21 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8,10-hexaen-12-one is sourced from PubChem (CID 70393273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).